About (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol
(2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol (PubChem CID 88882116) has the molecular formula C19H24O5S2
and a molecular weight of 396.53 g/mol. Its IUPAC name is (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol.
Molecular Properties
| Compound Name | (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol |
| PubChem CID | 88882116 |
| Molecular Formula | C19H24O5S2 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.11 |
| IUPAC Name | (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol |
| SMILES | CCC[C@H](CO)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O5S2/c1-2-9-16(15-20)14-19(25(21,22)17-10-5-3-6-11-17)26(23,24)18-12-7-4-8-13-18/h3-8,10-13,16,19-20H,2,9,14-15H2,1H3/t16-/m0/s1 |
| InChIKey | AFUIQFCFFZSYBS-INIZCTEOSA-N |
| XLogP | 3.06 |
| TPSA | 88.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol?
The IUPAC name of (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol (CID 88882116) is (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol.
What is the SMILES notation for (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol?
The canonical SMILES for (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol is CCC[C@H](CO)CC(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1.
What is the InChIKey of (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol?
The InChIKey is AFUIQFCFFZSYBS-INIZCTEOSA-N. The full InChI is InChI=1S/C19H24O5S2/c1-2-9-16(15-20)14-19(25(21,22)17-10-5-3-6-11-17)26(23,24)18-12-7-4-8-13-18/h3-8,10-13,16,19-20H,2,9,14-15H2,1H3/t16-/m0/s1.
What are the key properties of (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol?
(2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol has a molecular weight of 396.53 g/mol, XLogP of 3.06, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[2,2-bis(benzenesulfonyl)ethyl]pentan-1-ol is sourced from PubChem (CID 88882116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).