C13H17NO3S — CID 88882136
(1R,4S)-3-(piperidine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbothioic S-acid (PubChem CID 88882136) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is (1R,4S)-3-(piperidine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbothioic S-acid.
| Compound Name | (1R,4S)-3-(piperidine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbothioic S-acid |
|---|---|
| PubChem CID | 88882136 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | (1R,4S)-3-(piperidine-1-carbonyl)-7-oxabicyclo[2.2.1]hept-5-ene-2-carbothioic S-acid |
| SMILES | O=C(S)C1C(C(=O)N2CCCCC2)[C@@H]2C=C[C@H]1O2 |
| InChI | InChI=1S/C13H17NO3S/c15-12(14-6-2-1-3-7-14)10-8-4-5-9(17-8)11(10)13(16)18/h4-5,8-11H,1-3,6-7H2,(H,16,18)/t8-,9+,10?,11?/m0/s1 |
| InChIKey | FMDQTQZURZLJPO-IZUQBHJASA-N |
| XLogP | 1.02 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|