About 1-aminopent-4-yn-2-yl acetate
1-aminopent-4-yn-2-yl acetate (PubChem CID 88882221) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-aminopent-4-yn-2-yl acetate.
Molecular Properties
| Compound Name | 1-aminopent-4-yn-2-yl acetate |
| PubChem CID | 88882221 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | 1-aminopent-4-yn-2-yl acetate |
| SMILES | C#CCC(CN)OC(C)=O |
| InChI | InChI=1S/C7H11NO2/c1-3-4-7(5-8)10-6(2)9/h1,7H,4-5,8H2,2H3 |
| InChIKey | TZUCEPPGWCXUAM-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-aminopent-4-yn-2-yl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopent-4-yn-2-yl acetate?
The IUPAC name of 1-aminopent-4-yn-2-yl acetate (CID 88882221) is 1-aminopent-4-yn-2-yl acetate.
What is the SMILES notation for 1-aminopent-4-yn-2-yl acetate?
The canonical SMILES for 1-aminopent-4-yn-2-yl acetate is C#CCC(CN)OC(C)=O.
What is the InChIKey of 1-aminopent-4-yn-2-yl acetate?
The InChIKey is TZUCEPPGWCXUAM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO2/c1-3-4-7(5-8)10-6(2)9/h1,7H,4-5,8H2,2H3.
What are the key properties of 1-aminopent-4-yn-2-yl acetate?
1-aminopent-4-yn-2-yl acetate has a molecular weight of 141.17 g/mol, XLogP of -0.10, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopent-4-yn-2-yl acetate is sourced from PubChem (CID 88882221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).