C14H24N2O3 — CID 88882287
(2E,5E)-4-(methoxymethyl)-N,N,N',N',4-pentamethylhepta-2,5-dienediamide (PubChem CID 88882287) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is (2E,5E)-4-(methoxymethyl)-N,N,N',N',4-pentamethylhepta-2,5-dienediamide.
| Compound Name | (2E,5E)-4-(methoxymethyl)-N,N,N',N',4-pentamethylhepta-2,5-dienediamide |
|---|---|
| PubChem CID | 88882287 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | (2E,5E)-4-(methoxymethyl)-N,N,N',N',4-pentamethylhepta-2,5-dienediamide |
| SMILES | COCC(C)(/C=C/C(=O)N(C)C)/C=C/C(=O)N(C)C |
| InChI | InChI=1S/C14H24N2O3/c1-14(11-19-6,9-7-12(17)15(2)3)10-8-13(18)16(4)5/h7-10H,11H2,1-6H3/b9-7+,10-8+ |
| InChIKey | UFUPATTVHCZESI-FIFLTTCUSA-N |
| XLogP | 0.93 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|