About 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine
1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine (PubChem CID 88882413) has the molecular formula C6H12N2
and a molecular weight of 112.18 g/mol. Its IUPAC name is 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine.
Molecular Properties
| Compound Name | 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine |
| PubChem CID | 88882413 |
| Molecular Formula | C6H12N2 |
| Molecular Weight | 112.18 g/mol |
| Exact Mass | 112.10 |
| IUPAC Name | 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine |
| SMILES | C=C/C=C\N(N)CC |
| InChI | InChI=1S/C6H12N2/c1-3-5-6-8(7)4-2/h3,5-6H,1,4,7H2,2H3/b6-5- |
| InChIKey | OJVKCRDIWRLJRV-WAYWQWQTSA-N |
| XLogP | 0.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.18 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine?
The IUPAC name of 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine (CID 88882413) is 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine.
What is the SMILES notation for 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine?
The canonical SMILES for 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine is C=C/C=C\N(N)CC.
What is the InChIKey of 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine?
The InChIKey is OJVKCRDIWRLJRV-WAYWQWQTSA-N. The full InChI is InChI=1S/C6H12N2/c1-3-5-6-8(7)4-2/h3,5-6H,1,4,7H2,2H3/b6-5-.
What are the key properties of 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine?
1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine has a molecular weight of 112.18 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1Z)-buta-1,3-dienyl]-1-ethylhydrazine is sourced from PubChem (CID 88882413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).