About (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine
(3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine (PubChem CID 88882494) has the molecular formula C14H29NS
and a molecular weight of 243.46 g/mol. Its IUPAC name is (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine.
Molecular Properties
| Compound Name | (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine |
| PubChem CID | 88882494 |
| Molecular Formula | C14H29NS |
| Molecular Weight | 243.46 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine |
| SMILES | C=C(CC(C)(C)CC(C)C)[C@@H](N)CCSC |
| InChI | InChI=1S/C14H29NS/c1-11(2)9-14(4,5)10-12(3)13(15)7-8-16-6/h11,13H,3,7-10,15H2,1-2,4-6H3/t13-/m0/s1 |
| InChIKey | LIYBULNRVVTLAL-ZDUSSCGKSA-N |
| XLogP | 4.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.46 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine?
The IUPAC name of (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine (CID 88882494) is (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine.
What is the SMILES notation for (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine?
The canonical SMILES for (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine is C=C(CC(C)(C)CC(C)C)[C@@H](N)CCSC.
What is the InChIKey of (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine?
The InChIKey is LIYBULNRVVTLAL-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H29NS/c1-11(2)9-14(4,5)10-12(3)13(15)7-8-16-6/h11,13H,3,7-10,15H2,1-2,4-6H3/t13-/m0/s1.
What are the key properties of (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine?
(3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine has a molecular weight of 243.46 g/mol, XLogP of 4.09, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6,6,8-trimethyl-4-methylidene-1-methylsulfanylnonan-3-amine is sourced from PubChem (CID 88882494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).