About [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate
[2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate (PubChem CID 88882650) has the molecular formula C12H5F3N2O4S2
and a molecular weight of 362.31 g/mol. Its IUPAC name is [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 88882650 |
| Molecular Formula | C12H5F3N2O4S2 |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.96 |
| IUPAC Name | [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate |
| SMILES | N#Cc1cc(-c2cc(C=O)sn2)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C12H5F3N2O4S2/c13-12(14,15)23(19,20)21-11-2-1-7(3-8(11)5-16)10-4-9(6-18)22-17-10/h1-4,6H |
| InChIKey | ULTHNDRIKNOVON-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 97.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate (CID 88882650) is [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate is N#Cc1cc(-c2cc(C=O)sn2)ccc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is ULTHNDRIKNOVON-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H5F3N2O4S2/c13-12(14,15)23(19,20)21-11-2-1-7(3-8(11)5-16)10-4-9(6-18)22-17-10/h1-4,6H.
What are the key properties of [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate?
[2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 362.31 g/mol, XLogP of 2.72, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [2-cyano-4-(5-formyl-1,2-thiazol-3-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 88882650), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).