C16H18N4O3 — CID 88883035
3-N-hydroxy-7-N-piperidin-4-ylquinoline-3,7-dicarboxamide (PubChem CID 88883035) has the molecular formula C16H18N4O3 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-N-hydroxy-7-N-piperidin-4-ylquinoline-3,7-dicarboxamide.
| Compound Name | 3-N-hydroxy-7-N-piperidin-4-ylquinoline-3,7-dicarboxamide |
|---|---|
| PubChem CID | 88883035 |
| Molecular Formula | C16H18N4O3 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 3-N-hydroxy-7-N-piperidin-4-ylquinoline-3,7-dicarboxamide |
| SMILES | O=C(NO)c1cnc2cc(C(=O)NC3CCNCC3)ccc2c1 |
| InChI | InChI=1S/C16H18N4O3/c21-15(19-13-3-5-17-6-4-13)11-2-1-10-7-12(16(22)20-23)9-18-14(10)8-11/h1-2,7-9,13,17,23H,3-6H2,(H,19,21)(H,20,22) |
| InChIKey | USASXRIAWLPWOV-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|