C24H22BN5O2 — CID 88883182
CID 88883182 (PubChem CID 88883182) has the molecular formula C24H22BN5O2 and a molecular weight of 423.29 g/mol.
| Compound Name | CID 88883182 |
|---|---|
| PubChem CID | 88883182 |
| Molecular Formula | C24H22BN5O2 |
| Molecular Weight | 423.29 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | — |
| SMILES | [B]c1ccc(NC(=O)c2ccccc2NC(=O)c2ccc(C3=NCCCN3C)cc2)nc1 |
| InChI | InChI=1S/C24H22BN5O2/c1-30-14-4-13-26-22(30)16-7-9-17(10-8-16)23(31)28-20-6-3-2-5-19(20)24(32)29-21-12-11-18(25)15-27-21/h2-3,5-12,15H,4,13-14H2,1H3,(H,28,31)(H,27,29,32) |
| InChIKey | LXYSCNVIOIPGED-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|