About 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine
1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine (PubChem CID 88883371) has the molecular formula C13H17N5O
and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine.
Molecular Properties
| Compound Name | 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine |
| PubChem CID | 88883371 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine |
| SMILES | CC(C)(C)C(C=O)/N=C(/NC#N)Nc1ccncc1 |
| InChI | InChI=1S/C13H17N5O/c1-13(2,3)11(8-19)18-12(16-9-14)17-10-4-6-15-7-5-10/h4-8,11H,1-3H3,(H2,15,16,17,18) |
| InChIKey | UBTRYOLQOQDXTB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine?
The IUPAC name of 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine (CID 88883371) is 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine.
What is the SMILES notation for 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine?
The canonical SMILES for 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine is CC(C)(C)C(C=O)/N=C(/NC#N)Nc1ccncc1.
What is the InChIKey of 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine?
The InChIKey is UBTRYOLQOQDXTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N5O/c1-13(2,3)11(8-19)18-12(16-9-14)17-10-4-6-15-7-5-10/h4-8,11H,1-3H3,(H2,15,16,17,18).
What are the key properties of 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine?
1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine has a molecular weight of 259.31 g/mol, XLogP of 1.53, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2-(3,3-dimethyl-1-oxobutan-2-yl)-3-pyridin-4-ylguanidine is sourced from PubChem (CID 88883371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).