C18H33NO6Si — CID 88883436
4-[(E,2S,3R)-2-acetamido-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl]oxy-4-oxobutanoic acid (PubChem CID 88883436) has the molecular formula C18H33NO6Si and a molecular weight of 387.55 g/mol. Its IUPAC name is 4-[(E,2S,3R)-2-acetamido-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl]oxy-4-oxobutanoic acid.
| Compound Name | 4-[(E,2S,3R)-2-acetamido-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl]oxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 88883436 |
| Molecular Formula | C18H33NO6Si |
| Molecular Weight | 387.55 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 4-[(E,2S,3R)-2-acetamido-1-[tert-butyl(dimethyl)silyl]oxyhex-4-en-3-yl]oxy-4-oxobutanoic acid |
| SMILES | C/C=C/[C@@H](OC(=O)CCC(=O)O)[C@H](CO[Si](C)(C)C(C)(C)C)NC(C)=O |
| InChI | InChI=1S/C18H33NO6Si/c1-8-9-15(25-17(23)11-10-16(21)22)14(19-13(2)20)12-24-26(6,7)18(3,4)5/h8-9,14-15H,10-12H2,1-7H3,(H,19,20)(H,21,22)/b9-8+/t14-,15+/m0/s1 |
| InChIKey | ZSGBGRZRYLPUMY-MATWNZDUSA-N |
| XLogP | 2.87 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.55 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|