C23H33NO4S — CID 88883474
4-[4,4-dimethyl-2-methylidene-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid (PubChem CID 88883474) has the molecular formula C23H33NO4S and a molecular weight of 419.59 g/mol. Its IUPAC name is 4-[4,4-dimethyl-2-methylidene-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid.
| Compound Name | 4-[4,4-dimethyl-2-methylidene-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 88883474 |
| Molecular Formula | C23H33NO4S |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 4-[4,4-dimethyl-2-methylidene-4a-(4-oxobutyl)-3,9a-dihydro-1H-carbazol-9-yl]butane-1-sulfonic acid |
| SMILES | C=C1CC2N(CCCCS(=O)(=O)O)c3ccccc3C2(CCCC=O)C(C)(C)C1 |
| InChI | InChI=1S/C23H33NO4S/c1-18-16-21-23(12-6-8-14-25,22(2,3)17-18)19-10-4-5-11-20(19)24(21)13-7-9-15-29(26,27)28/h4-5,10-11,14,21H,1,6-9,12-13,15-17H2,2-3H3,(H,26,27,28) |
| InChIKey | GSICQKCSFDQKGG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|