C19H20FN3O2 — CID 88883805
2-fluoro-N-hydroxy-4-[(1S,4S)-5-(3-methylphenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide (PubChem CID 88883805) has the molecular formula C19H20FN3O2 and a molecular weight of 341.39 g/mol. Its IUPAC name is 2-fluoro-N-hydroxy-4-[(1S,4S)-5-(3-methylphenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide.
| Compound Name | 2-fluoro-N-hydroxy-4-[(1S,4S)-5-(3-methylphenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide |
|---|---|
| PubChem CID | 88883805 |
| Molecular Formula | C19H20FN3O2 |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 2-fluoro-N-hydroxy-4-[(1S,4S)-5-(3-methylphenyl)-2,5-diazabicyclo[2.2.1]heptan-2-yl]benzamide |
| SMILES | Cc1cccc(N2C[C@@H]3C[C@H]2CN3c2ccc(C(=O)NO)c(F)c2)c1 |
| InChI | InChI=1S/C19H20FN3O2/c1-12-3-2-4-13(7-12)22-10-16-8-15(22)11-23(16)14-5-6-17(18(20)9-14)19(24)21-25/h2-7,9,15-16,25H,8,10-11H2,1H3,(H,21,24)/t15-,16-/m0/s1 |
| InChIKey | XFYBEGGGGVFCKB-HOTGVXAUSA-N |
| XLogP | 2.72 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|