C12H15IN2O5 — CID 88883816
1-[(4R,6R,6aS)-2,2-dimethyl-6-(tritiomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-iodopyrimidine-2,4-dione (PubChem CID 88883816) has the molecular formula C12H15IN2O5 and a molecular weight of 396.17 g/mol. Its IUPAC name is 1-[(4R,6R,6aS)-2,2-dimethyl-6-(tritiomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-iodopyrimidine-2,4-dione.
| Compound Name | 1-[(4R,6R,6aS)-2,2-dimethyl-6-(tritiomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-iodopyrimidine-2,4-dione |
|---|---|
| PubChem CID | 88883816 |
| Molecular Formula | C12H15IN2O5 |
| Molecular Weight | 396.17 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | 1-[(4R,6R,6aS)-2,2-dimethyl-6-(tritiomethyl)-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]-6-iodopyrimidine-2,4-dione |
| SMILES | [3H]C[C@H]1O[C@@H](n2c(I)cc(=O)[nH]c2=O)C2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C12H15IN2O5/c1-5-8-9(20-12(2,3)19-8)10(18-5)15-6(13)4-7(16)14-11(15)17/h4-5,8-10H,1-3H3,(H,14,16,17)/t5-,8+,9?,10-/m1/s1/i1T |
| InChIKey | UWBVQIOTAUBXFQ-LAUZEDTNSA-N |
| XLogP | 0.58 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.17 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|