C23H26O6S — CID 88883978
[(1R)-13-hydroxy-9-methoxy-6,10-dimethyl-2-methylidene-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate (PubChem CID 88883978) has the molecular formula C23H26O6S and a molecular weight of 430.52 g/mol. Its IUPAC name is [(1R)-13-hydroxy-9-methoxy-6,10-dimethyl-2-methylidene-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate.
| Compound Name | [(1R)-13-hydroxy-9-methoxy-6,10-dimethyl-2-methylidene-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88883978 |
| Molecular Formula | C23H26O6S |
| Molecular Weight | 430.52 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | [(1R)-13-hydroxy-9-methoxy-6,10-dimethyl-2-methylidene-8-oxatetracyclo[7.3.1.01,5.06,10]trideca-4,11-dien-11-yl] 4-methylbenzenesulfonate |
| SMILES | C=C1CC=C2C3(C)COC4(OC)C(O)[C@]12C=C(OS(=O)(=O)c1ccc(C)cc1)C34C |
| InChI | InChI=1S/C23H26O6S/c1-14-6-9-16(10-7-14)30(25,26)29-18-12-22-15(2)8-11-17(22)20(3)13-28-23(27-5,19(22)24)21(18,20)4/h6-7,9-12,19,24H,2,8,13H2,1,3-5H3/t19?,20?,21?,22-,23?/m1/s1 |
| InChIKey | ODHWERMOECNPPO-XRDBWRKDSA-N |
| XLogP | 3.23 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.52 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|