C22H18N2O2 — CID 88884137
(E)-5-(3-ethynylanilino)-4-[(3-ethynylphenyl)iminomethyl]pent-4-enoic acid (PubChem CID 88884137) has the molecular formula C22H18N2O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is (E)-5-(3-ethynylanilino)-4-[(3-ethynylphenyl)iminomethyl]pent-4-enoic acid.
| Compound Name | (E)-5-(3-ethynylanilino)-4-[(3-ethynylphenyl)iminomethyl]pent-4-enoic acid |
|---|---|
| PubChem CID | 88884137 |
| Molecular Formula | C22H18N2O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | (E)-5-(3-ethynylanilino)-4-[(3-ethynylphenyl)iminomethyl]pent-4-enoic acid |
| SMILES | C#Cc1cccc(/N=C/C(=C/Nc2cccc(C#C)c2)CCC(=O)O)c1 |
| InChI | InChI=1S/C22H18N2O2/c1-3-17-7-5-9-20(13-17)23-15-19(11-12-22(25)26)16-24-21-10-6-8-18(4-2)14-21/h1-2,5-10,13-16,23H,11-12H2,(H,25,26)/b19-15+,24-16+ |
| InChIKey | HRIPBHDMBMJWKO-NZWMEJTDSA-N |
| XLogP | 4.21 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|