About 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol
3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol (PubChem CID 88884173) has the molecular formula C31H26N2O2S
and a molecular weight of 490.63 g/mol. Its IUPAC name is 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol.
Molecular Properties
| Compound Name | 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol |
| PubChem CID | 88884173 |
| Molecular Formula | C31H26N2O2S |
| Molecular Weight | 490.63 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol |
| SMILES | CC1(C)c2ccccc2N(Cc2ccc(-c3ccccc3)cc2)C12C=Cc1cc(N=O)cc(S)c1O2 |
| InChI | InChI=1S/C31H26N2O2S/c1-30(2)26-10-6-7-11-27(26)33(20-21-12-14-23(15-13-21)22-8-4-3-5-9-22)31(30)17-16-24-18-25(32-34)19-28(36)29(24)35-31/h3-19,36H,20H2,1-2H3 |
| InChIKey | SXLUZAYWYFVYND-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 41.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 490.63 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol?
The IUPAC name of 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol (CID 88884173) is 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol.
What is the SMILES notation for 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol?
The canonical SMILES for 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol is CC1(C)c2ccccc2N(Cc2ccc(-c3ccccc3)cc2)C12C=Cc1cc(N=O)cc(S)c1O2.
What is the InChIKey of 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol?
The InChIKey is SXLUZAYWYFVYND-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H26N2O2S/c1-30(2)26-10-6-7-11-27(26)33(20-21-12-14-23(15-13-21)22-8-4-3-5-9-22)31(30)17-16-24-18-25(32-34)19-28(36)29(24)35-31/h3-19,36H,20H2,1-2H3.
What are the key properties of 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol?
3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol has a molecular weight of 490.63 g/mol, XLogP of 8.14, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3',3'-dimethyl-6-nitroso-1'-[(4-phenylphenyl)methyl]spiro[chromene-2,2'-indole]-8-thiol is sourced from PubChem (CID 88884173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).