C30H14F2N2O — CID 88884306
(2E)-2-[(15Z)-15-(1-cyanoethylidene)-6,18-difluoro-9-hexacyclo[11.11.0.02,10.03,8.014,22.016,21]tetracosa-1(13),2(10),3(8),4,6,11,14(22),16(21),17,19,23-undecaenylidene]-3-oxopropanenitrile (PubChem CID 88884306) has the molecular formula C30H14F2N2O and a molecular weight of 456.45 g/mol. Its IUPAC name is (2E)-2-[(15Z)-15-(1-cyanoethylidene)-6,18-difluoro-9-hexacyclo[11.11.0.02,10.03,8.014,22.016,21]tetracosa-1(13),2(10),3(8),4,6,11,14(22),16(21),17,19,23-undecaenylidene]-3-oxopropanenitrile.
| Compound Name | (2E)-2-[(15Z)-15-(1-cyanoethylidene)-6,18-difluoro-9-hexacyclo[11.11.0.02,10.03,8.014,22.016,21]tetracosa-1(13),2(10),3(8),4,6,11,14(22),16(21),17,19,23-undecaenylidene]-3-oxopropanenitrile |
|---|---|
| PubChem CID | 88884306 |
| Molecular Formula | C30H14F2N2O |
| Molecular Weight | 456.45 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (2E)-2-[(15Z)-15-(1-cyanoethylidene)-6,18-difluoro-9-hexacyclo[11.11.0.02,10.03,8.014,22.016,21]tetracosa-1(13),2(10),3(8),4,6,11,14(22),16(21),17,19,23-undecaenylidene]-3-oxopropanenitrile |
| SMILES | C/C(C#N)=C1\c2cc(F)ccc2-c2ccc3c4c(ccc3c21)/C(=C(\C#N)C=O)c1cc(F)ccc1-4 |
| InChI | InChI=1S/C30H14F2N2O/c1-15(12-33)27-25-10-17(31)2-4-19(25)20-6-7-21-22(30(20)27)8-9-24-28(16(13-34)14-35)26-11-18(32)3-5-23(26)29(21)24/h2-11,14H,1H3/b27-15-,28-16- |
| InChIKey | NJXDSDFQNSXRGJ-USYBVIFISA-N |
| XLogP | 6.95 |
| TPSA | 64.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.45 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|