About 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine
6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine (PubChem CID 88884399) has the molecular formula C22H27ClN4O
and a molecular weight of 398.94 g/mol. Its IUPAC name is 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine |
| PubChem CID | 88884399 |
| Molecular Formula | C22H27ClN4O |
| Molecular Weight | 398.94 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine |
| SMILES | CCC1=Nc2cnc(Cl)cc2CN1c1ccc(OCCCN2CCCC2)cc1 |
| InChI | InChI=1S/C22H27ClN4O/c1-2-22-25-20-15-24-21(23)14-17(20)16-27(22)18-6-8-19(9-7-18)28-13-5-12-26-10-3-4-11-26/h6-9,14-15H,2-5,10-13,16H2,1H3 |
| InChIKey | MLZMORPEDMQXST-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 40.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.94 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine?
The IUPAC name of 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine (CID 88884399) is 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine.
What is the SMILES notation for 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine?
The canonical SMILES for 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine is CCC1=Nc2cnc(Cl)cc2CN1c1ccc(OCCCN2CCCC2)cc1.
What is the InChIKey of 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine?
The InChIKey is MLZMORPEDMQXST-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H27ClN4O/c1-2-22-25-20-15-24-21(23)14-17(20)16-27(22)18-6-8-19(9-7-18)28-13-5-12-26-10-3-4-11-26/h6-9,14-15H,2-5,10-13,16H2,1H3.
What are the key properties of 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine?
6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine has a molecular weight of 398.94 g/mol, XLogP of 5.06, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-ethyl-3-[4-(3-pyrrolidin-1-ylpropoxy)phenyl]-4H-pyrido[3,4-d]pyrimidine is sourced from PubChem (CID 88884399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).