C27H31F3N2O4 — CID 88884469
2-methyl-2-[[3-[[4-methyl-2-[(1E,3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trienyl]-1,3-oxazol-5-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]propanoic acid (PubChem CID 88884469) has the molecular formula C27H31F3N2O4 and a molecular weight of 504.55 g/mol. Its IUPAC name is 2-methyl-2-[[3-[[4-methyl-2-[(1E,3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trienyl]-1,3-oxazol-5-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]propanoic acid.
| Compound Name | 2-methyl-2-[[3-[[4-methyl-2-[(1E,3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trienyl]-1,3-oxazol-5-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]propanoic acid |
|---|---|
| PubChem CID | 88884469 |
| Molecular Formula | C27H31F3N2O4 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | 2-methyl-2-[[3-[[4-methyl-2-[(1E,3E,5Z)-4-(trifluoromethyl)hepta-1,3,5-trienyl]-1,3-oxazol-5-yl]methyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]oxy]propanoic acid |
| SMILES | C/C=C\C(=C/C=C/c1nc(C)c(CN2CCc3ccc(OC(C)(C)C(=O)O)cc3CC2)o1)C(F)(F)F |
| InChI | InChI=1S/C27H31F3N2O4/c1-5-7-21(27(28,29)30)8-6-9-24-31-18(2)23(35-24)17-32-14-12-19-10-11-22(16-20(19)13-15-32)36-26(3,4)25(33)34/h5-11,16H,12-15,17H2,1-4H3,(H,33,34)/b7-5-,9-6+,21-8+ |
| InChIKey | YFVXHTHBUQPHLW-PJLLOIEPSA-N |
| XLogP | 5.90 |
| TPSA | 75.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|