About 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione
4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione (PubChem CID 88884634) has the molecular formula C8H6O4
and a molecular weight of 166.13 g/mol. Its IUPAC name is 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione |
| PubChem CID | 88884634 |
| Molecular Formula | C8H6O4 |
| Molecular Weight | 166.13 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)C2C1=CC=CC2O |
| InChI | InChI=1S/C8H6O4/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3,5-6,9H |
| InChIKey | TWGSRZHBICQNLI-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.13 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione?
The IUPAC name of 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione (CID 88884634) is 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione.
What is the SMILES notation for 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione?
The canonical SMILES for 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione is O=C1OC(=O)C2C1=CC=CC2O.
What is the InChIKey of 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione?
The InChIKey is TWGSRZHBICQNLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6O4/c9-5-3-1-2-4-6(5)8(11)12-7(4)10/h1-3,5-6,9H.
What are the key properties of 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione?
4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione has a molecular weight of 166.13 g/mol, XLogP of -0.46, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-3a,4-dihydro-2-benzofuran-1,3-dione is sourced from PubChem (CID 88884634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).