C15H22F2O — CID 88884757
[3-[(3E)-8,8-difluoroocta-1,3-dien-4-yl]cyclohex-3-en-1-yl]methanol (PubChem CID 88884757) has the molecular formula C15H22F2O and a molecular weight of 256.34 g/mol. Its IUPAC name is [3-[(3E)-8,8-difluoroocta-1,3-dien-4-yl]cyclohex-3-en-1-yl]methanol.
| Compound Name | [3-[(3E)-8,8-difluoroocta-1,3-dien-4-yl]cyclohex-3-en-1-yl]methanol |
|---|---|
| PubChem CID | 88884757 |
| Molecular Formula | C15H22F2O |
| Molecular Weight | 256.34 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | [3-[(3E)-8,8-difluoroocta-1,3-dien-4-yl]cyclohex-3-en-1-yl]methanol |
| SMILES | C=C/C=C(\CCCC(F)F)C1=CCCC(CO)C1 |
| InChI | InChI=1S/C15H22F2O/c1-2-5-13(7-4-9-15(16)17)14-8-3-6-12(10-14)11-18/h2,5,8,12,15,18H,1,3-4,6-7,9-11H2/b13-5+ |
| InChIKey | XGZOSHMIEXZJSO-WLRTZDKTSA-N |
| XLogP | 4.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.34 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|