About 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide
2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide (PubChem CID 88884793) has the molecular formula C12H12IN3O2
and a molecular weight of 357.15 g/mol. Its IUPAC name is 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide.
Molecular Properties
| Compound Name | 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide |
| PubChem CID | 88884793 |
| Molecular Formula | C12H12IN3O2 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide |
| SMILES | COc1cccc(C2=NC(N)=IC(C(N)=O)=C2)c1 |
| InChI | InChI=1S/C12H12IN3O2/c1-18-8-4-2-3-7(5-8)10-6-9(11(14)17)13-12(15)16-10/h2-6H,1H3,(H2,14,17)(H2,15,16) |
| InChIKey | XMNXKPSJCAXDQP-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide?
The IUPAC name of 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide (CID 88884793) is 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide.
What is the SMILES notation for 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide?
The canonical SMILES for 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide is COc1cccc(C2=NC(N)=IC(C(N)=O)=C2)c1.
What is the InChIKey of 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide?
The InChIKey is XMNXKPSJCAXDQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12IN3O2/c1-18-8-4-2-3-7(5-8)10-6-9(11(14)17)13-12(15)16-10/h2-6H,1H3,(H2,14,17)(H2,15,16).
What are the key properties of 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide?
2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide has a molecular weight of 357.15 g/mol, XLogP of 0.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-(3-methoxyphenyl)-1λ3-ioda-3-azacyclohexa-1,3,5-triene-6-carboxamide is sourced from PubChem (CID 88884793), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).