About 7-methyltriphenylen-2-ol
7-methyltriphenylen-2-ol (PubChem CID 88884826) has the molecular formula C19H14O
and a molecular weight of 258.32 g/mol. Its IUPAC name is 7-methyltriphenylen-2-ol.
Molecular Properties
| Compound Name | 7-methyltriphenylen-2-ol |
| PubChem CID | 88884826 |
| Molecular Formula | C19H14O |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 7-methyltriphenylen-2-ol |
| SMILES | Cc1ccc2c3ccc(O)cc3c3ccccc3c2c1 |
| InChI | InChI=1S/C19H14O/c1-12-6-8-16-17-9-7-13(20)11-19(17)15-5-3-2-4-14(15)18(16)10-12/h2-11,20H,1H3 |
| InChIKey | ZRMRBVUUCIENKF-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 7-methyltriphenylen-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyltriphenylen-2-ol?
The IUPAC name of 7-methyltriphenylen-2-ol (CID 88884826) is 7-methyltriphenylen-2-ol.
What is the SMILES notation for 7-methyltriphenylen-2-ol?
The canonical SMILES for 7-methyltriphenylen-2-ol is Cc1ccc2c3ccc(O)cc3c3ccccc3c2c1.
What is the InChIKey of 7-methyltriphenylen-2-ol?
The InChIKey is ZRMRBVUUCIENKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14O/c1-12-6-8-16-17-9-7-13(20)11-19(17)15-5-3-2-4-14(15)18(16)10-12/h2-11,20H,1H3.
What are the key properties of 7-methyltriphenylen-2-ol?
7-methyltriphenylen-2-ol has a molecular weight of 258.32 g/mol, XLogP of 5.16, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyltriphenylen-2-ol is sourced from PubChem (CID 88884826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).