C16H15FN2O — CID 88885004
6-(4-fluorophenyl)-5-[(2E)-penta-2,4-dien-2-yl]-7,7a-dihydroimidazo[2,1-b][1,3]oxazole (PubChem CID 88885004) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-5-[(2E)-penta-2,4-dien-2-yl]-7,7a-dihydroimidazo[2,1-b][1,3]oxazole.
| Compound Name | 6-(4-fluorophenyl)-5-[(2E)-penta-2,4-dien-2-yl]-7,7a-dihydroimidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 88885004 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 6-(4-fluorophenyl)-5-[(2E)-penta-2,4-dien-2-yl]-7,7a-dihydroimidazo[2,1-b][1,3]oxazole |
| SMILES | C=C/C=C(\C)C1=C(c2ccc(F)cc2)NC2OC=CN12 |
| InChI | InChI=1S/C16H15FN2O/c1-3-4-11(2)15-14(12-5-7-13(17)8-6-12)18-16-19(15)9-10-20-16/h3-10,16,18H,1H2,2H3/b11-4+ |
| InChIKey | GSFZFTYXTPPDDY-NYYWCZLTSA-N |
| XLogP | 3.32 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|