C17H16FNO — CID 88885035
3-[(1E,3E)-1-(4-fluorophenyl)-3-methylhexa-1,3,5-trien-2-yl]-2-methylidene-1,3-oxazole (PubChem CID 88885035) has the molecular formula C17H16FNO and a molecular weight of 269.32 g/mol. Its IUPAC name is 3-[(1E,3E)-1-(4-fluorophenyl)-3-methylhexa-1,3,5-trien-2-yl]-2-methylidene-1,3-oxazole.
| Compound Name | 3-[(1E,3E)-1-(4-fluorophenyl)-3-methylhexa-1,3,5-trien-2-yl]-2-methylidene-1,3-oxazole |
|---|---|
| PubChem CID | 88885035 |
| Molecular Formula | C17H16FNO |
| Molecular Weight | 269.32 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 3-[(1E,3E)-1-(4-fluorophenyl)-3-methylhexa-1,3,5-trien-2-yl]-2-methylidene-1,3-oxazole |
| SMILES | C=C/C=C(C)/C(=C\c1ccc(F)cc1)N1C=COC1=C |
| InChI | InChI=1S/C17H16FNO/c1-4-5-13(2)17(19-10-11-20-14(19)3)12-15-6-8-16(18)9-7-15/h4-12H,1,3H2,2H3/b13-5+,17-12+ |
| InChIKey | ULHMWKQJTUIJDZ-NZUGCCFKSA-N |
| XLogP | 4.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.32 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|