C18H25FN2O — CID 88885052
(1Z,3E)-1-(4-fluorophenyl)-3-methyl-2-N-[1-[(Z)-prop-1-enoxy]ethyl]hexa-1,3-diene-1,2-diamine (PubChem CID 88885052) has the molecular formula C18H25FN2O and a molecular weight of 304.41 g/mol. Its IUPAC name is (1Z,3E)-1-(4-fluorophenyl)-3-methyl-2-N-[1-[(Z)-prop-1-enoxy]ethyl]hexa-1,3-diene-1,2-diamine.
| Compound Name | (1Z,3E)-1-(4-fluorophenyl)-3-methyl-2-N-[1-[(Z)-prop-1-enoxy]ethyl]hexa-1,3-diene-1,2-diamine |
|---|---|
| PubChem CID | 88885052 |
| Molecular Formula | C18H25FN2O |
| Molecular Weight | 304.41 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (1Z,3E)-1-(4-fluorophenyl)-3-methyl-2-N-[1-[(Z)-prop-1-enoxy]ethyl]hexa-1,3-diene-1,2-diamine |
| SMILES | C/C=C\OC(C)NC(=C(\N)c1ccc(F)cc1)/C(C)=C/CC |
| InChI | InChI=1S/C18H25FN2O/c1-5-7-13(3)18(21-14(4)22-12-6-2)17(20)15-8-10-16(19)11-9-15/h6-12,14,21H,5,20H2,1-4H3/b12-6-,13-7+,18-17- |
| InChIKey | MGKPROSHRMZNAU-XYXKRSMZSA-N |
| XLogP | 4.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|