C18H13F6N5O2 — CID 88885243
N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-2,4,5-trifluoro-3-methoxybenzamide (PubChem CID 88885243) has the molecular formula C18H13F6N5O2 and a molecular weight of 445.32 g/mol. Its IUPAC name is N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-2,4,5-trifluoro-3-methoxybenzamide.
| Compound Name | N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-2,4,5-trifluoro-3-methoxybenzamide |
|---|---|
| PubChem CID | 88885243 |
| Molecular Formula | C18H13F6N5O2 |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | N-[6-amino-5-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]-2-pyridinyl]-2,4,5-trifluoro-3-methoxybenzamide |
| SMILES | COc1c(F)c(F)cc(C(=O)Nc2ccc(-c3cc(C(F)(F)F)nn3C)c(N)n2)c1F |
| InChI | InChI=1S/C18H13F6N5O2/c1-29-10(6-11(28-29)18(22,23)24)7-3-4-12(26-16(7)25)27-17(30)8-5-9(19)14(21)15(31-2)13(8)20/h3-6H,1-2H3,(H3,25,26,27,30) |
| InChIKey | DHGULHBQKBIPTF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|