C18H14BrFN2O3 — CID 88885251
(2Z)-N-[5-(6-bromo-1,3-benzodioxol-5-yl)-2-pyridinyl]-3-fluoro-2-methylpenta-2,4-dienamide (PubChem CID 88885251) has the molecular formula C18H14BrFN2O3 and a molecular weight of 405.22 g/mol. Its IUPAC name is (2Z)-N-[5-(6-bromo-1,3-benzodioxol-5-yl)-2-pyridinyl]-3-fluoro-2-methylpenta-2,4-dienamide.
| Compound Name | (2Z)-N-[5-(6-bromo-1,3-benzodioxol-5-yl)-2-pyridinyl]-3-fluoro-2-methylpenta-2,4-dienamide |
|---|---|
| PubChem CID | 88885251 |
| Molecular Formula | C18H14BrFN2O3 |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | (2Z)-N-[5-(6-bromo-1,3-benzodioxol-5-yl)-2-pyridinyl]-3-fluoro-2-methylpenta-2,4-dienamide |
| SMILES | C=C/C(F)=C(\C)C(=O)Nc1ccc(-c2cc3c(cc2Br)OCO3)cn1 |
| InChI | InChI=1S/C18H14BrFN2O3/c1-3-14(20)10(2)18(23)22-17-5-4-11(8-21-17)12-6-15-16(7-13(12)19)25-9-24-15/h3-8H,1,9H2,2H3,(H,21,22,23)/b14-10- |
| InChIKey | DSKCGPXNITWGNP-UVTDQMKNSA-N |
| XLogP | 4.61 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|