C7H12N2 — CID 88885466
(1Z,3Z)-5-N-methylhexa-1,3,5-triene-1,5-diamine (PubChem CID 88885466) has the molecular formula C7H12N2 and a molecular weight of 124.19 g/mol. Its IUPAC name is (1Z,3Z)-5-N-methylhexa-1,3,5-triene-1,5-diamine.
| Compound Name | (1Z,3Z)-5-N-methylhexa-1,3,5-triene-1,5-diamine |
|---|---|
| PubChem CID | 88885466 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | (1Z,3Z)-5-N-methylhexa-1,3,5-triene-1,5-diamine |
| SMILES | C=C(/C=C\C=C/N)NC |
| InChI | InChI=1S/C7H12N2/c1-7(9-2)5-3-4-6-8/h3-6,9H,1,8H2,2H3/b5-3-,6-4- |
| InChIKey | SLCNANWXVYCPNN-GLIMQPGKSA-N |
| XLogP | 0.75 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|