C45H26F6N4 — CID 88885606
9-[4-(4-pyren-1-yl-6-pyridin-2-yl-2-pyridinyl)-2,5-bis(trifluoromethyl)phenyl]-1,2-dihydropyrido[3,4-b]indole (PubChem CID 88885606) has the molecular formula C45H26F6N4 and a molecular weight of 736.72 g/mol. Its IUPAC name is 9-[4-(4-pyren-1-yl-6-pyridin-2-yl-2-pyridinyl)-2,5-bis(trifluoromethyl)phenyl]-1,2-dihydropyrido[3,4-b]indole.
| Compound Name | 9-[4-(4-pyren-1-yl-6-pyridin-2-yl-2-pyridinyl)-2,5-bis(trifluoromethyl)phenyl]-1,2-dihydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 88885606 |
| Molecular Formula | C45H26F6N4 |
| Molecular Weight | 736.72 g/mol |
| Exact Mass | 736.21 |
| IUPAC Name | 9-[4-(4-pyren-1-yl-6-pyridin-2-yl-2-pyridinyl)-2,5-bis(trifluoromethyl)phenyl]-1,2-dihydropyrido[3,4-b]indole |
| SMILES | FC(F)(F)c1cc(-n2c3c(c4ccccc42)C=CNC3)c(C(F)(F)F)cc1-c1cc(-c2ccc3ccc4cccc5ccc2c3c45)cc(-c2ccccn2)n1 |
| InChI | InChI=1S/C45H26F6N4/c46-44(47,48)34-23-40(55-39-10-2-1-8-30(39)31-17-19-52-24-41(31)55)35(45(49,50)51)22-33(34)37-20-28(21-38(54-37)36-9-3-4-18-53-36)29-15-13-27-12-11-25-6-5-7-26-14-16-32(29)43(27)42(25)26/h1-23,52H,24H2 |
| InChIKey | BRCLVKUVQFPOEG-UHFFFAOYSA-N |
| XLogP | 12.43 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.72 |
| LogP ≤ 5 | 12.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|