About 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine
5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine (PubChem CID 88885670) has the molecular formula C12H25NS
and a molecular weight of 215.41 g/mol. Its IUPAC name is 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine.
Molecular Properties
| Compound Name | 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine |
| PubChem CID | 88885670 |
| Molecular Formula | C12H25NS |
| Molecular Weight | 215.41 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine |
| SMILES | C=CC(CCSC)N(CCC)CCC |
| InChI | InChI=1S/C12H25NS/c1-5-9-13(10-6-2)12(7-3)8-11-14-4/h7,12H,3,5-6,8-11H2,1-2,4H3 |
| InChIKey | KWYHXIHHPGICNK-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.41 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine?
The IUPAC name of 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine (CID 88885670) is 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine.
What is the SMILES notation for 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine?
The canonical SMILES for 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine is C=CC(CCSC)N(CCC)CCC.
What is the InChIKey of 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine?
The InChIKey is KWYHXIHHPGICNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NS/c1-5-9-13(10-6-2)12(7-3)8-11-14-4/h7,12H,3,5-6,8-11H2,1-2,4H3.
What are the key properties of 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine?
5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine has a molecular weight of 215.41 g/mol, XLogP of 3.42, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfanyl-N,N-dipropylpent-1-en-3-amine is sourced from PubChem (CID 88885670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).