C25H23N5O3 — CID 88885706
N-(4-amino-3-methanimidoylphenyl)-6-methyl-2-oxo-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 88885706) has the molecular formula C25H23N5O3 and a molecular weight of 441.49 g/mol. Its IUPAC name is N-(4-amino-3-methanimidoylphenyl)-6-methyl-2-oxo-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | N-(4-amino-3-methanimidoylphenyl)-6-methyl-2-oxo-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 88885706 |
| Molecular Formula | C25H23N5O3 |
| Molecular Weight | 441.49 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | N-(4-amino-3-methanimidoylphenyl)-6-methyl-2-oxo-4-(4-phenoxyphenyl)-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | [H]/N=C/c1cc(NC(=O)C2=C(C)NC(=O)NC2c2ccc(Oc3ccccc3)cc2)ccc1N |
| InChI | InChI=1S/C25H23N5O3/c1-15-22(24(31)29-18-9-12-21(27)17(13-18)14-26)23(30-25(32)28-15)16-7-10-20(11-8-16)33-19-5-3-2-4-6-19/h2-14,23,26H,27H2,1H3,(H,29,31)(H2,28,30,32)/b26-14+ |
| InChIKey | KHBOSVGOLBAMDZ-VULFUBBASA-N |
| XLogP | 4.33 |
| TPSA | 129.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.49 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|