C12H20S — CID 88885973
(4E,6E)-2,7-dimethyl-4-methylsulfanylnona-2,4,6-triene (PubChem CID 88885973) has the molecular formula C12H20S and a molecular weight of 196.36 g/mol. Its IUPAC name is (4E,6E)-2,7-dimethyl-4-methylsulfanylnona-2,4,6-triene.
| Compound Name | (4E,6E)-2,7-dimethyl-4-methylsulfanylnona-2,4,6-triene |
|---|---|
| PubChem CID | 88885973 |
| Molecular Formula | C12H20S |
| Molecular Weight | 196.36 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (4E,6E)-2,7-dimethyl-4-methylsulfanylnona-2,4,6-triene |
| SMILES | CC/C(C)=C/C=C(\C=C(C)C)SC |
| InChI | InChI=1S/C12H20S/c1-6-11(4)7-8-12(13-5)9-10(2)3/h7-9H,6H2,1-5H3/b11-7+,12-8+ |
| InChIKey | KDZQDWIIWRIGCS-MKICQXMISA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|