About (E)-1,2-difluoro-4-methylsulfanylhept-3-ene
(E)-1,2-difluoro-4-methylsulfanylhept-3-ene (PubChem CID 88885976) has the molecular formula C8H14F2S
and a molecular weight of 180.26 g/mol. Its IUPAC name is (E)-1,2-difluoro-4-methylsulfanylhept-3-ene.
Molecular Properties
| Compound Name | (E)-1,2-difluoro-4-methylsulfanylhept-3-ene |
| PubChem CID | 88885976 |
| Molecular Formula | C8H14F2S |
| Molecular Weight | 180.26 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (E)-1,2-difluoro-4-methylsulfanylhept-3-ene |
| SMILES | CCC/C(=C\C(F)CF)SC |
| InChI | InChI=1S/C8H14F2S/c1-3-4-8(11-2)5-7(10)6-9/h5,7H,3-4,6H2,1-2H3/b8-5+ |
| InChIKey | AONRKDMDMSNDKG-VMPITWQZSA-N |
| XLogP | 3.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (E)-1,2-difluoro-4-methylsulfanylhept-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1,2-difluoro-4-methylsulfanylhept-3-ene?
The IUPAC name of (E)-1,2-difluoro-4-methylsulfanylhept-3-ene (CID 88885976) is (E)-1,2-difluoro-4-methylsulfanylhept-3-ene.
What is the SMILES notation for (E)-1,2-difluoro-4-methylsulfanylhept-3-ene?
The canonical SMILES for (E)-1,2-difluoro-4-methylsulfanylhept-3-ene is CCC/C(=C\C(F)CF)SC.
What is the InChIKey of (E)-1,2-difluoro-4-methylsulfanylhept-3-ene?
The InChIKey is AONRKDMDMSNDKG-VMPITWQZSA-N. The full InChI is InChI=1S/C8H14F2S/c1-3-4-8(11-2)5-7(10)6-9/h5,7H,3-4,6H2,1-2H3/b8-5+.
What are the key properties of (E)-1,2-difluoro-4-methylsulfanylhept-3-ene?
(E)-1,2-difluoro-4-methylsulfanylhept-3-ene has a molecular weight of 180.26 g/mol, XLogP of 3.34, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1,2-difluoro-4-methylsulfanylhept-3-ene is sourced from PubChem (CID 88885976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).