C18H18FIN4O3 — CID 88886034
3-[(2-fluoro-4-iodocyclohexa-2,4-dien-1-yl)amino]-N-pyrrolidin-3-yloxyfuro[3,2-c]pyridine-2-carboxamide (PubChem CID 88886034) has the molecular formula C18H18FIN4O3 and a molecular weight of 484.27 g/mol. Its IUPAC name is 3-[(2-fluoro-4-iodocyclohexa-2,4-dien-1-yl)amino]-N-pyrrolidin-3-yloxyfuro[3,2-c]pyridine-2-carboxamide.
| Compound Name | 3-[(2-fluoro-4-iodocyclohexa-2,4-dien-1-yl)amino]-N-pyrrolidin-3-yloxyfuro[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 88886034 |
| Molecular Formula | C18H18FIN4O3 |
| Molecular Weight | 484.27 g/mol |
| Exact Mass | 484.04 |
| IUPAC Name | 3-[(2-fluoro-4-iodocyclohexa-2,4-dien-1-yl)amino]-N-pyrrolidin-3-yloxyfuro[3,2-c]pyridine-2-carboxamide |
| SMILES | O=C(NOC1CCNC1)c1oc2ccncc2c1NC1CC=C(I)C=C1F |
| InChI | InChI=1S/C18H18FIN4O3/c19-13-7-10(20)1-2-14(13)23-16-12-9-22-6-4-15(12)26-17(16)18(25)24-27-11-3-5-21-8-11/h1,4,6-7,9,11,14,21,23H,2-3,5,8H2,(H,24,25) |
| InChIKey | XFSQLYFNOKRVBV-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|