C10H17ClO2 — CID 88886083
(2Z,4Z)-3-(2-chloroethyl)-1,6-dimethoxyhexa-2,4-diene (PubChem CID 88886083) has the molecular formula C10H17ClO2 and a molecular weight of 204.70 g/mol. Its IUPAC name is (2Z,4Z)-3-(2-chloroethyl)-1,6-dimethoxyhexa-2,4-diene.
| Compound Name | (2Z,4Z)-3-(2-chloroethyl)-1,6-dimethoxyhexa-2,4-diene |
|---|---|
| PubChem CID | 88886083 |
| Molecular Formula | C10H17ClO2 |
| Molecular Weight | 204.70 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2Z,4Z)-3-(2-chloroethyl)-1,6-dimethoxyhexa-2,4-diene |
| SMILES | COC/C=C\C(=C/COC)CCCl |
| InChI | InChI=1S/C10H17ClO2/c1-12-8-3-4-10(5-7-11)6-9-13-2/h3-4,6H,5,7-9H2,1-2H3/b4-3-,10-6+ |
| InChIKey | CRVXYPHREFRQKZ-GEEJUIKGSA-N |
| XLogP | 2.39 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.70 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|