C33H28N2O4S — CID 88886098
[(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxo-2-phenyl-9,10-dihydrothiopyrano[3,2-c]carbazol-3-ylidene]amino] acetate (PubChem CID 88886098) has the molecular formula C33H28N2O4S and a molecular weight of 548.66 g/mol. Its IUPAC name is [(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxo-2-phenyl-9,10-dihydrothiopyrano[3,2-c]carbazol-3-ylidene]amino] acetate.
| Compound Name | [(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxo-2-phenyl-9,10-dihydrothiopyrano[3,2-c]carbazol-3-ylidene]amino] acetate |
|---|---|
| PubChem CID | 88886098 |
| Molecular Formula | C33H28N2O4S |
| Molecular Weight | 548.66 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | [(E)-[7-ethyl-10-(2-methylbenzoyl)-4-oxo-2-phenyl-9,10-dihydrothiopyrano[3,2-c]carbazol-3-ylidene]amino] acetate |
| SMILES | CCn1c2c(c3c4c(ccc31)C(=O)/C(=N\OC(C)=O)C(c1ccccc1)S4)=CC(C(=O)c1ccccc1C)CC=2 |
| InChI | InChI=1S/C33H28N2O4S/c1-4-35-26-16-14-22(30(37)23-13-9-8-10-19(23)2)18-25(26)28-27(35)17-15-24-31(38)29(34-39-20(3)36)32(40-33(24)28)21-11-6-5-7-12-21/h5-13,15-18,22,32H,4,14H2,1-3H3/b34-29+ |
| InChIKey | YJLTUMFVOFJTLP-RIHQVDFKSA-N |
| XLogP | 5.38 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.66 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|