C8H9BN2O2 — CID 88886130
4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole (PubChem CID 88886130) has the molecular formula C8H9BN2O2 and a molecular weight of 175.98 g/mol. Its IUPAC name is 4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole.
| Compound Name | 4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole |
|---|---|
| PubChem CID | 88886130 |
| Molecular Formula | C8H9BN2O2 |
| Molecular Weight | 175.98 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 4-(4,5-dimethylidene-1,3,2-dioxaborolan-2-yl)-1-methylpyrazole |
| SMILES | C=C1OB(c2cnn(C)c2)OC1=C |
| InChI | InChI=1S/C8H9BN2O2/c1-6-7(2)13-9(12-6)8-4-10-11(3)5-8/h4-5H,1-2H2,3H3 |
| InChIKey | QCIIVECUSZYAPN-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.98 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|