C35H15F10N5 — CID 88886158
10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1,3-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene (PubChem CID 88886158) has the molecular formula C35H15F10N5 and a molecular weight of 695.52 g/mol. Its IUPAC name is 10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1,3-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene.
| Compound Name | 10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1,3-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
|---|---|
| PubChem CID | 88886158 |
| Molecular Formula | C35H15F10N5 |
| Molecular Weight | 695.52 g/mol |
| Exact Mass | 695.12 |
| IUPAC Name | 10-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-13,13-dimethyl-1,3-diazapentacyclo[10.7.1.02,7.08,20.014,19]icosa-2(7),3,5,8(20),9,11,14,16,18-nonaene |
| SMILES | CC1(C)c2ccccc2-n2c3ncccc3c3cc(-c4nc(-c5c(F)c(F)c(F)c(F)c5F)nc(-c5c(F)c(F)c(F)c(F)c5F)n4)cc1c32 |
| InChI | InChI=1S/C35H15F10N5/c1-35(2)15-7-3-4-8-17(15)50-30-14(13-6-5-9-46-34(13)50)10-12(11-16(30)35)31-47-32(18-20(36)24(40)28(44)25(41)21(18)37)49-33(48-31)19-22(38)26(42)29(45)27(43)23(19)39/h3-11H,1-2H3 |
| InChIKey | ACCINLAMSFCACS-UHFFFAOYSA-N |
| XLogP | 9.40 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.52 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|