C16H21N — CID 88886230
(Z)-N-[(4E,6Z)-4-ethenyl-6-methylnona-1,2,4,6-tetraen-3-yl]but-2-en-1-imine (PubChem CID 88886230) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is (Z)-N-[(4E,6Z)-4-ethenyl-6-methylnona-1,2,4,6-tetraen-3-yl]but-2-en-1-imine.
| Compound Name | (Z)-N-[(4E,6Z)-4-ethenyl-6-methylnona-1,2,4,6-tetraen-3-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 88886230 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | (Z)-N-[(4E,6Z)-4-ethenyl-6-methylnona-1,2,4,6-tetraen-3-yl]but-2-en-1-imine |
| SMILES | C=C=C(/N=C/C=C\C)/C(C=C)=C/C(C)=C\CC |
| InChI | InChI=1S/C16H21N/c1-6-10-12-17-16(9-4)15(8-3)13-14(5)11-7-2/h6,8,10-13H,3-4,7H2,1-2,5H3/b10-6-,14-11-,15-13+,17-12+ |
| InChIKey | KZRLVCRORFGBFI-QCZXXOTQSA-N |
| XLogP | 4.77 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|