C11H27NO6Si4 — CID 88886554
2-(3-isocyanatopropyl)-2-methoxy-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 88886554) has the molecular formula C11H27NO6Si4 and a molecular weight of 381.68 g/mol. Its IUPAC name is 2-(3-isocyanatopropyl)-2-methoxy-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2-(3-isocyanatopropyl)-2-methoxy-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 88886554 |
| Molecular Formula | C11H27NO6Si4 |
| Molecular Weight | 381.68 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 2-(3-isocyanatopropyl)-2-methoxy-4,4,6,6,8,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CO[Si]1(CCCN=C=O)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C11H27NO6Si4/c1-14-22(10-8-9-12-11-13)17-20(4,5)15-19(2,3)16-21(6,7)18-22/h8-10H2,1-7H3 |
| InChIKey | CMLXDPZKBNFMHJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|