C52H22F10N4 — CID 88886975
9-[2-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]carbazole (PubChem CID 88886975) has the molecular formula C52H22F10N4 and a molecular weight of 892.76 g/mol. Its IUPAC name is 9-[2-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]carbazole.
| Compound Name | 9-[2-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]carbazole |
|---|---|
| PubChem CID | 88886975 |
| Molecular Formula | C52H22F10N4 |
| Molecular Weight | 892.76 g/mol |
| Exact Mass | 892.17 |
| IUPAC Name | 9-[2-[4,6-bis(2,3,4,5,6-pentafluorophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]carbazole |
| SMILES | Fc1c(F)c(F)c(-c2nc(-c3ccc4c(c3)C3(c5ccccc5-4)c4ccccc4-c4ccc(-n5c6ccccc6c6ccccc65)cc43)nc(-c3c(F)c(F)c(F)c(F)c3F)n2)c(F)c1F |
| InChI | InChI=1S/C52H22F10N4/c53-39-37(40(54)44(58)47(61)43(39)57)50-63-49(64-51(65-50)38-41(55)45(59)48(62)46(60)42(38)56)23-17-19-27-25-9-1-5-13-31(25)52(33(27)21-23)32-14-6-2-10-26(32)28-20-18-24(22-34(28)52)66-35-15-7-3-11-29(35)30-12-4-8-16-36(30)66/h1-22H |
| InChIKey | BNNMDRZYTRDTNH-UHFFFAOYSA-N |
| XLogP | 13.70 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.76 |
| LogP ≤ 5 | 13.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|