C54H28F2N6 — CID 88886977
9-[2-[4,6-bis(4-isocyanophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]-3,6-difluorocarbazole (PubChem CID 88886977) has the molecular formula C54H28F2N6 and a molecular weight of 798.86 g/mol. Its IUPAC name is 9-[2-[4,6-bis(4-isocyanophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]-3,6-difluorocarbazole.
| Compound Name | 9-[2-[4,6-bis(4-isocyanophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]-3,6-difluorocarbazole |
|---|---|
| PubChem CID | 88886977 |
| Molecular Formula | C54H28F2N6 |
| Molecular Weight | 798.86 g/mol |
| Exact Mass | 798.23 |
| IUPAC Name | 9-[2-[4,6-bis(4-isocyanophenyl)-1,3,5-triazin-2-yl]-9,9'-spirobi[fluorene]-2'-yl]-3,6-difluorocarbazole |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccc([N+]#[C-])cc3)nc(-c3ccc4c(c3)C3(c5ccccc5-4)c4ccccc4-c4ccc(-n5c6ccc(F)cc6c6cc(F)ccc65)cc43)n2)cc1 |
| InChI | InChI=1S/C54H28F2N6/c1-57-36-18-11-31(12-19-36)51-59-52(32-13-20-37(58-2)21-14-32)61-53(60-51)33-15-23-41-39-7-3-5-9-45(39)54(47(41)27-33)46-10-6-4-8-40(46)42-24-22-38(30-48(42)54)62-49-25-16-34(55)28-43(49)44-29-35(56)17-26-50(44)62/h3-30H |
| InChIKey | FUAZWCGCTASDGN-UHFFFAOYSA-N |
| XLogP | 13.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.86 |
| LogP ≤ 5 | 13.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|