About piperazine-2,3-dithione
piperazine-2,3-dithione (PubChem CID 88887197) has the molecular formula C4H6N2S2
and a molecular weight of 146.24 g/mol. Its IUPAC name is piperazine-2,3-dithione.
Molecular Properties
| Compound Name | piperazine-2,3-dithione |
| PubChem CID | 88887197 |
| Molecular Formula | C4H6N2S2 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | piperazine-2,3-dithione |
| SMILES | S=C1NCCNC1=S |
| InChI | InChI=1S/C4H6N2S2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8) |
| InChIKey | YFNOWTICKCXYEC-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze piperazine-2,3-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazine-2,3-dithione?
The IUPAC name of piperazine-2,3-dithione (CID 88887197) is piperazine-2,3-dithione.
What is the SMILES notation for piperazine-2,3-dithione?
The canonical SMILES for piperazine-2,3-dithione is S=C1NCCNC1=S.
What is the InChIKey of piperazine-2,3-dithione?
The InChIKey is YFNOWTICKCXYEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S2/c7-3-4(8)6-2-1-5-3/h1-2H2,(H,5,7)(H,6,8).
What are the key properties of piperazine-2,3-dithione?
piperazine-2,3-dithione has a molecular weight of 146.24 g/mol, XLogP of -0.17, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for piperazine-2,3-dithione is sourced from PubChem (CID 88887197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).