About 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid
1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid (PubChem CID 88887362) has the molecular formula C20H24N2O8SSi
and a molecular weight of 480.57 g/mol. Its IUPAC name is 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid.
Molecular Properties
| Compound Name | 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid |
| PubChem CID | 88887362 |
| Molecular Formula | C20H24N2O8SSi |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid |
| SMILES | CO[Si](CCCNc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O)(OC)OC |
| InChI | InChI=1S/C20H24N2O8SSi/c1-28-32(29-2,30-3)10-6-9-22-14-11-15(31(25,26)27)18(21)17-16(14)19(23)12-7-4-5-8-13(12)20(17)24/h4-5,7-8,11,22H,6,9-10,21H2,1-3H3,(H,25,26,27) |
| InChIKey | QMMCDKBKMREDOL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid?
The IUPAC name of 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid (CID 88887362) is 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid.
What is the SMILES notation for 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid?
The canonical SMILES for 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid is CO[Si](CCCNc1cc(S(=O)(=O)O)c(N)c2c1C(=O)c1ccccc1C2=O)(OC)OC.
What is the InChIKey of 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid?
The InChIKey is QMMCDKBKMREDOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H24N2O8SSi/c1-28-32(29-2,30-3)10-6-9-22-14-11-15(31(25,26)27)18(21)17-16(14)19(23)12-7-4-5-8-13(12)20(17)24/h4-5,7-8,11,22H,6,9-10,21H2,1-3H3,(H,25,26,27).
What are the key properties of 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid?
1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid has a molecular weight of 480.57 g/mol, XLogP of 1.97, 9 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-9,10-dioxo-4-(3-trimethoxysilylpropylamino)anthracene-2-sulfonic acid is sourced from PubChem (CID 88887362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).