C16H11Cl4NO2S — CID 88887430
2,3,4,5-tetrachloro-6-[methyl-(4-methylphenyl)carbamothioyl]benzoic acid (PubChem CID 88887430) has the molecular formula C16H11Cl4NO2S and a molecular weight of 423.15 g/mol. Its IUPAC name is 2,3,4,5-tetrachloro-6-[methyl-(4-methylphenyl)carbamothioyl]benzoic acid.
| Compound Name | 2,3,4,5-tetrachloro-6-[methyl-(4-methylphenyl)carbamothioyl]benzoic acid |
|---|---|
| PubChem CID | 88887430 |
| Molecular Formula | C16H11Cl4NO2S |
| Molecular Weight | 423.15 g/mol |
| Exact Mass | 420.93 |
| IUPAC Name | 2,3,4,5-tetrachloro-6-[methyl-(4-methylphenyl)carbamothioyl]benzoic acid |
| SMILES | Cc1ccc(N(C)C(=S)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C(=O)O)cc1 |
| InChI | InChI=1S/C16H11Cl4NO2S/c1-7-3-5-8(6-4-7)21(2)15(24)9-10(16(22)23)12(18)14(20)13(19)11(9)17/h3-6H,1-2H3,(H,22,23) |
| InChIKey | ATUGBEMJBWBMTE-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.15 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|