About [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol
[(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol (PubChem CID 88887587) has the molecular formula C11H20O3
and a molecular weight of 200.28 g/mol. Its IUPAC name is [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol.
Molecular Properties
| Compound Name | [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol |
| PubChem CID | 88887587 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol |
| SMILES | CC(C)[C@@H]1OC(C(O)C2CO2)C[C@H]1C |
| InChI | InChI=1S/C11H20O3/c1-6(2)11-7(3)4-8(14-11)10(12)9-5-13-9/h6-12H,4-5H2,1-3H3/t7-,8?,9?,10?,11+/m1/s1 |
| InChIKey | SNJCEYJTKANJCS-NUEDSASKSA-N |
| XLogP | 1.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol?
The IUPAC name of [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol (CID 88887587) is [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol.
What is the SMILES notation for [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol?
The canonical SMILES for [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol is CC(C)[C@@H]1OC(C(O)C2CO2)C[C@H]1C.
What is the InChIKey of [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol?
The InChIKey is SNJCEYJTKANJCS-NUEDSASKSA-N. The full InChI is InChI=1S/C11H20O3/c1-6(2)11-7(3)4-8(14-11)10(12)9-5-13-9/h6-12H,4-5H2,1-3H3/t7-,8?,9?,10?,11+/m1/s1.
What are the key properties of [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol?
[(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol has a molecular weight of 200.28 g/mol, XLogP of 1.20, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(4R,5S)-4-methyl-5-propan-2-yloxolan-2-yl]-(oxiran-2-yl)methanol is sourced from PubChem (CID 88887587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).