C10H20O4P+ — CID 88888127
[(3E,5Z)-2,4-dimethylocta-3,5-dienoxy]-trihydroxyphosphanium (PubChem CID 88888127) has the molecular formula C10H20O4P+ and a molecular weight of 235.24 g/mol. Its IUPAC name is [(3E,5Z)-2,4-dimethylocta-3,5-dienoxy]-trihydroxyphosphanium.
| Compound Name | [(3E,5Z)-2,4-dimethylocta-3,5-dienoxy]-trihydroxyphosphanium |
|---|---|
| PubChem CID | 88888127 |
| Molecular Formula | C10H20O4P+ |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | [(3E,5Z)-2,4-dimethylocta-3,5-dienoxy]-trihydroxyphosphanium |
| SMILES | CC/C=C\C(C)=C\C(C)CO[P+](O)(O)O |
| InChI | InChI=1S/C10H20O4P/c1-4-5-6-9(2)7-10(3)8-14-15(11,12)13/h5-7,10-13H,4,8H2,1-3H3/q+1/b6-5-,9-7+ |
| InChIKey | UQRYAMJPWLFKDQ-BZWSEGBZSA-N |
| XLogP | 2.21 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|