About (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine
(3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine (PubChem CID 88888144) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine.
Molecular Properties
| Compound Name | (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine |
| PubChem CID | 88888144 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine |
| SMILES | C=C/C(=C\C=C(N)N)OC |
| InChI | InChI=1S/C7H12N2O/c1-3-6(10-2)4-5-7(8)9/h3-5H,1,8-9H2,2H3/b6-4+ |
| InChIKey | WQVOHQUPVKOKMD-GQCTYLIASA-N |
| XLogP | 0.46 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine?
The IUPAC name of (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine (CID 88888144) is (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine.
What is the SMILES notation for (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine?
The canonical SMILES for (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine is C=C/C(=C\C=C(N)N)OC.
What is the InChIKey of (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine?
The InChIKey is WQVOHQUPVKOKMD-GQCTYLIASA-N. The full InChI is InChI=1S/C7H12N2O/c1-3-6(10-2)4-5-7(8)9/h3-5H,1,8-9H2,2H3/b6-4+.
What are the key properties of (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine?
(3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine has a molecular weight of 140.19 g/mol, XLogP of 0.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-4-methoxyhexa-1,3,5-triene-1,1-diamine is sourced from PubChem (CID 88888144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).